C21H48N6O — CID 23400717
2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3-methylbutylamino)hexanamide (PubChem CID 23400717) has the molecular formula C21H48N6O and a molecular weight of 400.66 g/mol. Its IUPAC name is 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3-methylbutylamino)hexanamide.
| Compound Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3-methylbutylamino)hexanamide |
|---|---|
| PubChem CID | 23400717 |
| Molecular Formula | C21H48N6O |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.39 |
| IUPAC Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3-methylbutylamino)hexanamide |
| SMILES | CC(C)CCNCCCCC(N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C21H48N6O/c1-19(2)10-18-26-12-4-3-9-20(23)21(28)27-17-8-16-25-14-6-5-13-24-15-7-11-22/h19-20,24-26H,3-18,22-23H2,1-2H3,(H,27,28) |
| InChIKey | CRCYSNDCJMMZFG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|