C30H33F6NO7 — CID 23400745
diethyl 2-[(E)-4-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]but-3-enyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 23400745) has the molecular formula C30H33F6NO7 and a molecular weight of 633.58 g/mol. Its IUPAC name is diethyl 2-[(E)-4-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]but-3-enyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[(E)-4-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]but-3-enyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 23400745 |
| Molecular Formula | C30H33F6NO7 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | diethyl 2-[(E)-4-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]but-3-enyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(CC/C=C/c1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C30H33F6NO7/c1-6-41-24(38)28(25(39)42-7-2,37-26(40)44-27(3,4)5)15-9-8-10-19-11-13-22(14-12-19)43-23-17-20(29(31,32)33)16-21(18-23)30(34,35)36/h8,10-14,16-18H,6-7,9,15H2,1-5H3,(H,37,40)/b10-8+ |
| InChIKey | UVOKSETZJLZYLC-CSKARUKUSA-N |
| XLogP | 7.70 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|