C24H41NO5Si — CID 23400757
tert-butyl N-[2,2-ditert-butyl-5-[2-(4-hydroxyphenyl)ethyl]-1,3,2-dioxasilinan-5-yl]carbamate (PubChem CID 23400757) has the molecular formula C24H41NO5Si and a molecular weight of 451.68 g/mol. Its IUPAC name is tert-butyl N-[2,2-ditert-butyl-5-[2-(4-hydroxyphenyl)ethyl]-1,3,2-dioxasilinan-5-yl]carbamate.
| Compound Name | tert-butyl N-[2,2-ditert-butyl-5-[2-(4-hydroxyphenyl)ethyl]-1,3,2-dioxasilinan-5-yl]carbamate |
|---|---|
| PubChem CID | 23400757 |
| Molecular Formula | C24H41NO5Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | tert-butyl N-[2,2-ditert-butyl-5-[2-(4-hydroxyphenyl)ethyl]-1,3,2-dioxasilinan-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CCc2ccc(O)cc2)CO[Si](C(C)(C)C)(C(C)(C)C)OC1 |
| InChI | InChI=1S/C24H41NO5Si/c1-21(2,3)30-20(27)25-24(15-14-18-10-12-19(26)13-11-18)16-28-31(29-17-24,22(4,5)6)23(7,8)9/h10-13,26H,14-17H2,1-9H3,(H,25,27) |
| InChIKey | GFDOTNSGGMEVHL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|