C17H19N5O2S — CID 23401128
N,N-diethyl-2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[3,4-d]pyrimidin-5-yl)-2-phenylacetamide (PubChem CID 23401128) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N,N-diethyl-2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[3,4-d]pyrimidin-5-yl)-2-phenylacetamide.
| Compound Name | N,N-diethyl-2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[3,4-d]pyrimidin-5-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 23401128 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N,N-diethyl-2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[3,4-d]pyrimidin-5-yl)-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)n1cnc2[nH][nH]c(=O)c2c1=S |
| InChI | InChI=1S/C17H19N5O2S/c1-3-21(4-2)16(24)13(11-8-6-5-7-9-11)22-10-18-14-12(17(22)25)15(23)20-19-14/h5-10,13H,3-4H2,1-2H3,(H2,19,20,23) |
| InChIKey | HMEVRPHPWYQGBO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|