About [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid
[1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid (PubChem CID 23401185) has the molecular formula C10H6N2O4
and a molecular weight of 218.17 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid.
Molecular Properties
| Compound Name | [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid |
| PubChem CID | 23401185 |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid |
| SMILES | O=C(O)c1cnnc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C10H6N2O4/c13-10(14)6-3-11-12-7-2-9-8(1-5(6)7)15-4-16-9/h1-3H,4H2,(H,13,14) |
| InChIKey | QXLBDCYPGDFBGS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid?
The IUPAC name of [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid (CID 23401185) is [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid.
What is the SMILES notation for [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid?
The canonical SMILES for [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid is O=C(O)c1cnnc2cc3c(cc12)OCO3.
What is the InChIKey of [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid?
The InChIKey is QXLBDCYPGDFBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O4/c13-10(14)6-3-11-12-7-2-9-8(1-5(6)7)15-4-16-9/h1-3H,4H2,(H,13,14).
What are the key properties of [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid?
[1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid has a molecular weight of 218.17 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]dioxolo[4,5-g]cinnoline-4-carboxylic acid is sourced from PubChem (CID 23401185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).