C34H26Cl2F6N4O5 — CID 23401213
2-(3,4-dichlorophenyl)-N-[(1R)-1-[4-oxo-3-[4-(2,2,2-trifluoroethoxy)phenyl]quinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 23401213) has the molecular formula C34H26Cl2F6N4O5 and a molecular weight of 755.50 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(1R)-1-[4-oxo-3-[4-(2,2,2-trifluoroethoxy)phenyl]quinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(1R)-1-[4-oxo-3-[4-(2,2,2-trifluoroethoxy)phenyl]quinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23401213 |
| Molecular Formula | C34H26Cl2F6N4O5 |
| Molecular Weight | 755.50 g/mol |
| Exact Mass | 754.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(1R)-1-[4-oxo-3-[4-(2,2,2-trifluoroethoxy)phenyl]quinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](c1nc2ccccc2c(=O)n1-c1ccc(OCC(F)(F)F)cc1)N(Cc1cccnc1)C(=O)Cc1ccc(Cl)c(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H25Cl2F3N4O3.C2HF3O2/c1-20(40(18-22-5-4-14-38-17-22)29(42)16-21-8-13-26(33)27(34)15-21)30-39-28-7-3-2-6-25(28)31(43)41(30)23-9-11-24(12-10-23)44-19-32(35,36)37;3-2(4,5)1(6)7/h2-15,17,20H,16,18-19H2,1H3;(H,6,7)/t20-;/m1./s1 |
| InChIKey | HBIVCJXFABVTDN-VEIFNGETSA-N |
| XLogP | 7.99 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.50 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |