About ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate
ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate (PubChem CID 23401463) has the molecular formula C19H23BrFNO3
and a molecular weight of 412.30 g/mol. Its IUPAC name is ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
| PubChem CID | 23401463 |
| Molecular Formula | C19H23BrFNO3 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
| SMILES | CCCC1(CC(=O)OCC)OCCc2c1[nH]c1c(C)cc(F)c(Br)c21 |
| InChI | InChI=1S/C19H23BrFNO3/c1-4-7-19(10-14(23)24-5-2)18-12(6-8-25-19)15-16(20)13(21)9-11(3)17(15)22-18/h9,22H,4-8,10H2,1-3H3 |
| InChIKey | JMISSZZELLTJQF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate?
The IUPAC name of ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate (CID 23401463) is ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate.
What is the SMILES notation for ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate?
The canonical SMILES for ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate is CCCC1(CC(=O)OCC)OCCc2c1[nH]c1c(C)cc(F)c(Br)c21.
What is the InChIKey of ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate?
The InChIKey is JMISSZZELLTJQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrFNO3/c1-4-7-19(10-14(23)24-5-2)18-12(6-8-25-19)15-16(20)13(21)9-11(3)17(15)22-18/h9,22H,4-8,10H2,1-3H3.
What are the key properties of ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate?
ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate has a molecular weight of 412.30 g/mol, XLogP of 4.90, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-bromo-6-fluoro-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate is sourced from PubChem (CID 23401463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).