C31H36N2O7S2 — CID 23402026
2-[(7S)-4-benzoyl-7-[5-(4-ethoxyphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 23402026) has the molecular formula C31H36N2O7S2 and a molecular weight of 612.77 g/mol. Its IUPAC name is 2-[(7S)-4-benzoyl-7-[5-(4-ethoxyphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(7S)-4-benzoyl-7-[5-(4-ethoxyphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 23402026 |
| Molecular Formula | C31H36N2O7S2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 2-[(7S)-4-benzoyl-7-[5-(4-ethoxyphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | CCOc1ccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCN(C(=O)c4ccccc4)CCS3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C31H36N2O7S2/c1-2-38-25-13-11-23(12-14-25)26-15-16-27(41-26)31(22-28(34)32-40-29-10-6-7-20-39-29)17-18-33(19-21-42(31,36)37)30(35)24-8-4-3-5-9-24/h3-5,8-9,11-16,29H,2,6-7,10,17-22H2,1H3,(H,32,34)/t29?,31-/m0/s1 |
| InChIKey | PAQKCMGELGVARE-RDFOUATCSA-N |
| XLogP | 4.93 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|