C11H9Cl3N4OS2 — CID 2340230
(2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2340230) has the molecular formula C11H9Cl3N4OS2 and a molecular weight of 383.71 g/mol. Its IUPAC name is (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2340230 |
| Molecular Formula | C11H9Cl3N4OS2 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@@H](Sc1nnc(N)s1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl3N4OS2/c1-4(20-11-18-17-10(15)21-11)9(19)16-8-3-6(13)5(12)2-7(8)14/h2-4H,1H3,(H2,15,17)(H,16,19)/t4-/m1/s1 |
| InChIKey | LJUDMNHRMVRTSP-SCSAIBSYSA-N |
| XLogP | 4.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|