C13H20N2 — CID 23402345
(2S,5R)-1-benzyl-2,5-dimethylpiperazine (PubChem CID 23402345) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2S,5R)-1-benzyl-2,5-dimethylpiperazine.
| Compound Name | (2S,5R)-1-benzyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 23402345 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2S,5R)-1-benzyl-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C)CN1 |
| InChI | InChI=1S/C13H20N2/c1-11-9-15(12(2)8-14-11)10-13-6-4-3-5-7-13/h3-7,11-12,14H,8-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | WJTCHBVEUFDSIK-NEPJUHHUSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |