About 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine
4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 23402543) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 23402543 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CN1CCC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H27N/c1-13(2,3)11-8-9-15(7)10-12(11)14(4,5)6/h8-10H2,1-7H3 |
| InChIKey | HYNOQMOCZDVDLE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine (CID 23402543) is 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine is CN1CCC(C(C)(C)C)=C(C(C)(C)C)C1.
What is the InChIKey of 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is HYNOQMOCZDVDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N/c1-13(2,3)11-8-9-15(7)10-12(11)14(4,5)6/h8-10H2,1-7H3.
What are the key properties of 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine?
4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 209.38 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 23402543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).