C14H26N2 — CID 23402552
5,6-ditert-butyl-1-methyl-2,7-dihydro-1,4-diazepine (PubChem CID 23402552) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-methyl-2,7-dihydro-1,4-diazepine.
| Compound Name | 5,6-ditert-butyl-1-methyl-2,7-dihydro-1,4-diazepine |
|---|---|
| PubChem CID | 23402552 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 5,6-ditert-butyl-1-methyl-2,7-dihydro-1,4-diazepine |
| SMILES | CN1CC=NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H26N2/c1-13(2,3)11-10-16(7)9-8-15-12(11)14(4,5)6/h8H,9-10H2,1-7H3 |
| InChIKey | BIFCOAMGTMJCQT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |