About 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one
5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one (PubChem CID 23402618) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one.
Molecular Properties
| Compound Name | 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one |
| PubChem CID | 23402618 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one |
| SMILES | CCCCc1cn(C)c(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C18H31NO/c1-9-10-11-13-12-19(8)16(18(5,6)7)14(15(13)20)17(2,3)4/h12H,9-11H2,1-8H3 |
| InChIKey | KWHVRUPMTCXUHB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one?
The IUPAC name of 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one (CID 23402618) is 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one.
What is the SMILES notation for 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one?
The canonical SMILES for 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one is CCCCc1cn(C)c(C(C)(C)C)c(C(C)(C)C)c1=O.
What is the InChIKey of 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one?
The InChIKey is KWHVRUPMTCXUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-9-10-11-13-12-19(8)16(18(5,6)7)14(15(13)20)17(2,3)4/h12H,9-11H2,1-8H3.
What are the key properties of 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one?
5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one has a molecular weight of 277.45 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2,3-ditert-butyl-1-methylpyridin-4-one is sourced from PubChem (CID 23402618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).