About 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone
1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 23402901) has the molecular formula C11H11F4N3O
and a molecular weight of 277.22 g/mol. Its IUPAC name is 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone |
| PubChem CID | 23402901 |
| Molecular Formula | C11H11F4N3O |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C11H11F4N3O/c1-6(19)17-2-4-18(5-3-17)9-7(12)10(14)16-11(15)8(9)13/h2-5H2,1H3 |
| InChIKey | HASUSASUVCJYDZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone (CID 23402901) is 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone is CC(=O)N1CCN(c2c(F)c(F)nc(F)c2F)CC1.
What is the InChIKey of 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone?
The InChIKey is HASUSASUVCJYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F4N3O/c1-6(19)17-2-4-18(5-3-17)9-7(12)10(14)16-11(15)8(9)13/h2-5H2,1H3.
What are the key properties of 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone?
1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone has a molecular weight of 277.22 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 23402901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).