C17H42O15Si8 — CID 23403199
1,3,7-tris(3-methoxypropyl)-5,9,11,13,15-pentamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane (PubChem CID 23403199) has the molecular formula C17H42O15Si8 and a molecular weight of 711.20 g/mol. Its IUPAC name is 1,3,7-tris(3-methoxypropyl)-5,9,11,13,15-pentamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane.
| Compound Name | 1,3,7-tris(3-methoxypropyl)-5,9,11,13,15-pentamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane |
|---|---|
| PubChem CID | 23403199 |
| Molecular Formula | C17H42O15Si8 |
| Molecular Weight | 711.20 g/mol |
| Exact Mass | 710.07 |
| IUPAC Name | 1,3,7-tris(3-methoxypropyl)-5,9,11,13,15-pentamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosane |
| SMILES | COCCC[Si]12O[Si]3(C)O[Si]4(C)O[Si](C)(O1)O[Si]1(CCCOC)O[Si](C)(O[Si](C)(O3)O[Si](CCCOC)(O4)O1)O2 |
| InChI | InChI=1S/C17H42O15Si8/c1-18-12-9-15-38-25-33(4)21-34(5)23-36(7,28-38)30-40(17-11-14-20-3)31-37(8,29-38)24-35(6,22-33)27-39(26-34,32-40)16-10-13-19-2/h9-17H2,1-8H3 |
| InChIKey | LPIUULDGICTPJQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 138.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|