C25H34N4O3S — CID 23403502
N-(2,6-dimethylphenyl)-2-[3,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfonyl)piperazin-1-yl]acetamide (PubChem CID 23403502) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 23403502 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3,5-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfonyl)piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CC(C)N(S(=O)(=O)c2ccc3c(c2)CNCC3)C(C)C1 |
| InChI | InChI=1S/C25H34N4O3S/c1-17-6-5-7-18(2)25(17)27-24(30)16-28-14-19(3)29(20(4)15-28)33(31,32)23-9-8-21-10-11-26-13-22(21)12-23/h5-9,12,19-20,26H,10-11,13-16H2,1-4H3,(H,27,30) |
| InChIKey | WJFYBWHFMUXFRL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |