C37H74N2O — CID 23403533
2-[5-butyl-3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide (PubChem CID 23403533) has the molecular formula C37H74N2O and a molecular weight of 563.01 g/mol. Its IUPAC name is 2-[5-butyl-3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide.
| Compound Name | 2-[5-butyl-3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 23403533 |
| Molecular Formula | C37H74N2O |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.58 |
| IUPAC Name | 2-[5-butyl-3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide |
| SMILES | CCCCCCCCC(C)NC1C(CCCCC)C(CCCC)C(C)(CCC)C(CC)(CC(=O)NCC)C1(C)C |
| InChI | InChI=1S/C37H74N2O/c1-11-17-20-21-22-24-25-30(7)39-34-31(26-23-18-12-2)32(27-19-13-3)36(10,28-14-4)37(15-5,35(34,8)9)29-33(40)38-16-6/h30-32,34,39H,11-29H2,1-10H3,(H,38,40) |
| InChIKey | OKHSUUMSVHNPFD-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|