About 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine
2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine (PubChem CID 23404703) has the molecular formula C15H15ClN4
and a molecular weight of 286.77 g/mol. Its IUPAC name is 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine.
Molecular Properties
| Compound Name | 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine |
| PubChem CID | 23404703 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine |
| SMILES | C[C@H](N=[N+]=[N-])[C@@H](Cc1ccc(Cl)cn1)c1ccccc1 |
| InChI | InChI=1S/C15H15ClN4/c1-11(19-20-17)15(12-5-3-2-4-6-12)9-14-8-7-13(16)10-18-14/h2-8,10-11,15H,9H2,1H3/t11-,15+/m0/s1 |
| InChIKey | NHLUVKGIUFIRAY-XHDPSFHLSA-N |
| XLogP | 4.76 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine?
The IUPAC name of 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine (CID 23404703) is 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine.
What is the SMILES notation for 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine?
The canonical SMILES for 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine is C[C@H](N=[N+]=[N-])[C@@H](Cc1ccc(Cl)cn1)c1ccccc1.
What is the InChIKey of 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine?
The InChIKey is NHLUVKGIUFIRAY-XHDPSFHLSA-N. The full InChI is InChI=1S/C15H15ClN4/c1-11(19-20-17)15(12-5-3-2-4-6-12)9-14-8-7-13(16)10-18-14/h2-8,10-11,15H,9H2,1H3/t11-,15+/m0/s1.
What are the key properties of 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine?
2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine has a molecular weight of 286.77 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,3S)-3-azido-2-phenylbutyl]-5-chloropyridine is sourced from PubChem (CID 23404703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).