About CID 23404927
CID 23404927 (PubChem CID 23404927) has the molecular formula C7H8BN3O
and a molecular weight of 160.97 g/mol.
Molecular Properties
| Compound Name | CID 23404927 |
| PubChem CID | 23404927 |
| Molecular Formula | C7H8BN3O |
| Molecular Weight | 160.97 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N(C)c1ncc(C)cn1 |
| InChI | InChI=1S/C7H8BN3O/c1-5-3-9-7(10-4-5)11(2)6(8)12/h3-4H,1-2H3 |
| InChIKey | DERMPIRWPXLSOT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.97 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23404927 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23404927?
The IUPAC name of CID 23404927 (CID 23404927) is not available.
What is the SMILES notation for CID 23404927?
The canonical SMILES for CID 23404927 is [B]C(=O)N(C)c1ncc(C)cn1.
What is the InChIKey of CID 23404927?
The InChIKey is DERMPIRWPXLSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BN3O/c1-5-3-9-7(10-4-5)11(2)6(8)12/h3-4H,1-2H3.
What are the key properties of CID 23404927?
CID 23404927 has a molecular weight of 160.97 g/mol, XLogP of 0.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23404927 is sourced from PubChem (CID 23404927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).