C22H30 — CID 23405147
3,9-ditert-butyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 23405147) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 3,9-ditert-butyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | 3,9-ditert-butyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 23405147 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3,9-ditert-butyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | CC(C)(C)c1cc2c(c3ccccc13)CC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C22H30/c1-21(2,3)16-12-11-15-13-20(22(4,5)6)18-10-8-7-9-17(18)19(15)14-16/h7-10,13,16H,11-12,14H2,1-6H3 |
| InChIKey | AMYKEZYBUBOWJP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |