C6H7F7O2 — CID 23405171
1,1,1,3,3,3-hexafluoro-2-(2-fluoroethoxy)-2-methoxypropane (PubChem CID 23405171) has the molecular formula C6H7F7O2 and a molecular weight of 244.11 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-fluoroethoxy)-2-methoxypropane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-fluoroethoxy)-2-methoxypropane |
|---|---|
| PubChem CID | 23405171 |
| Molecular Formula | C6H7F7O2 |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-fluoroethoxy)-2-methoxypropane |
| SMILES | COC(OCCF)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7O2/c1-14-4(5(8,9)10,6(11,12)13)15-3-2-7/h2-3H2,1H3 |
| InChIKey | BKSHLVPOCXRGAN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|