C14H17ClN4O6S2 — CID 23405189
2-[3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)-ethylamino]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 23405189) has the molecular formula C14H17ClN4O6S2 and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-[3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)-ethylamino]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)-ethylamino]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 23405189 |
| Molecular Formula | C14H17ClN4O6S2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-[3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)-ethylamino]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | CCN(c1cccc(S(=O)(=O)CCOS(=O)(=O)O)c1)c1nc(C)nc(Cl)n1 |
| InChI | InChI=1S/C14H17ClN4O6S2/c1-3-19(14-17-10(2)16-13(15)18-14)11-5-4-6-12(9-11)26(20,21)8-7-25-27(22,23)24/h4-6,9H,3,7-8H2,1-2H3,(H,22,23,24) |
| InChIKey | MNNFVVJGGSUEFJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 139.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|