About carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+)
carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) (PubChem CID 23405276) has the molecular formula C19H33NNiOP+
and a molecular weight of 381.15 g/mol. Its IUPAC name is carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+).
Molecular Properties
| Compound Name | carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) |
| PubChem CID | 23405276 |
| Molecular Formula | C19H33NNiOP+ |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) |
| SMILES | Cc1cccc(C)c1[N-]C(=O)C[PH+](C(C)(C)C)C(C)(C)C.[CH3-].[Ni+2] |
| InChI | InChI=1S/C18H30NOP.CH3.Ni/c1-13-10-9-11-14(2)16(13)19-15(20)12-21(17(3,4)5)18(6,7)8;;/h9-11H,12H2,1-8H3,(H,19,20);1H3;/q;-1;+2 |
| InChIKey | FHSZZICUNCQEGF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+)?
The IUPAC name of carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) (CID 23405276) is carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+).
What is the SMILES notation for carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+)?
The canonical SMILES for carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) is Cc1cccc(C)c1[N-]C(=O)C[PH+](C(C)(C)C)C(C)(C)C.[CH3-].[Ni+2].
What is the InChIKey of carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+)?
The InChIKey is FHSZZICUNCQEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30NOP.CH3.Ni/c1-13-10-9-11-14(2)16(13)19-15(20)12-21(17(3,4)5)18(6,7)8;;/h9-11H,12H2,1-8H3,(H,19,20);1H3;/q;-1;+2.
What are the key properties of carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+)?
carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) has a molecular weight of 381.15 g/mol, XLogP of 6.09, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(2-ditert-butylphosphaniumylacetyl)-(2,6-dimethylphenyl)azanide;nickel(2+) is sourced from PubChem (CID 23405276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).