C16H22F6O2 — CID 23405305
1-[2-(1-butoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]bicyclo[2.2.1]hept-2-ene (PubChem CID 23405305) has the molecular formula C16H22F6O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 1-[2-(1-butoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1-[2-(1-butoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 23405305 |
| Molecular Formula | C16H22F6O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-[2-(1-butoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]bicyclo[2.2.1]hept-2-ene |
| SMILES | CCCCOC(C)OC(C(F)(F)F)(C(F)(F)F)C12C=CC(CC1)C2 |
| InChI | InChI=1S/C16H22F6O2/c1-3-4-9-23-11(2)24-14(15(17,18)19,16(20,21)22)13-7-5-12(10-13)6-8-13/h5,7,11-12H,3-4,6,8-10H2,1-2H3 |
| InChIKey | JLSCIDLBIGJNNM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|