C17H18F10O2 — CID 23405351
2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]oxyoxane (PubChem CID 23405351) has the molecular formula C17H18F10O2 and a molecular weight of 444.31 g/mol. Its IUPAC name is 2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]oxyoxane.
| Compound Name | 2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]oxyoxane |
|---|---|
| PubChem CID | 23405351 |
| Molecular Formula | C17H18F10O2 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yl]oxyoxane |
| SMILES | FC(F)(F)C(F)(F)C(OC1CCCCO1)(C1CC2C=CC1C2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F10O2/c18-14(19,16(22,23)24)13(15(20,21)17(25,26)27,29-12-3-1-2-6-28-12)11-8-9-4-5-10(11)7-9/h4-5,9-12H,1-3,6-8H2 |
| InChIKey | NLRKZMVEEJQJML-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|