C34H50F12O2 — CID 23405352
2-[5-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]-1-adamantyl]-3,5-dimethylhexan-3-yl]-2-methyl-7,7-bis(trifluoromethyl)oxepane (PubChem CID 23405352) has the molecular formula C34H50F12O2 and a molecular weight of 718.75 g/mol. Its IUPAC name is 2-[5-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]-1-adamantyl]-3,5-dimethylhexan-3-yl]-2-methyl-7,7-bis(trifluoromethyl)oxepane.
| Compound Name | 2-[5-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]-1-adamantyl]-3,5-dimethylhexan-3-yl]-2-methyl-7,7-bis(trifluoromethyl)oxepane |
|---|---|
| PubChem CID | 23405352 |
| Molecular Formula | C34H50F12O2 |
| Molecular Weight | 718.75 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | 2-[5-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]-1-adamantyl]-3,5-dimethylhexan-3-yl]-2-methyl-7,7-bis(trifluoromethyl)oxepane |
| SMILES | CCC(C)(CC(C)(C)C12CC3CC(C1)CC(C(OC(C)(C)C)(C(F)(F)F)C(F)(F)F)(C3)C2)C1(C)CCCCC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C34H50F12O2/c1-9-25(7,26(8)12-10-11-13-29(48-26,31(35,36)37)32(38,39)40)19-24(5,6)27-15-21-14-22(16-27)18-28(17-21,20-27)30(33(41,42)43,34(44,45)46)47-23(2,3)4/h21-22H,9-20H2,1-8H3 |
| InChIKey | MZRCGTLHMAXVGX-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.75 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |