C23H22F18O2 — CID 23405368
2-[5-(2-ethenyl-1-bicyclo[2.2.1]heptanyl)-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]oxyoxane (PubChem CID 23405368) has the molecular formula C23H22F18O2 and a molecular weight of 672.39 g/mol. Its IUPAC name is 2-[5-(2-ethenyl-1-bicyclo[2.2.1]heptanyl)-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]oxyoxane.
| Compound Name | 2-[5-(2-ethenyl-1-bicyclo[2.2.1]heptanyl)-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]oxyoxane |
|---|---|
| PubChem CID | 23405368 |
| Molecular Formula | C23H22F18O2 |
| Molecular Weight | 672.39 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | 2-[5-(2-ethenyl-1-bicyclo[2.2.1]heptanyl)-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]oxyoxane |
| SMILES | C=CC1CC2CCC1(C(OC1CCCCO1)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2 |
| InChI | InChI=1S/C23H22F18O2/c1-2-12-9-11-6-7-14(12,10-11)15(43-13-5-3-4-8-42-13,16(24,25)18(28,29)20(32,33)22(36,37)38)17(26,27)19(30,31)21(34,35)23(39,40)41/h2,11-13H,1,3-10H2 |
| InChIKey | HHIYELNUYYJCRJ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.39 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|