About 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane
2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane (PubChem CID 23405418) has the molecular formula C10H15F3O
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane.
Molecular Properties
| Compound Name | 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane |
| PubChem CID | 23405418 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane |
| SMILES | C=CC1(C)CCCC(C)(C(F)(F)F)O1 |
| InChI | InChI=1S/C10H15F3O/c1-4-8(2)6-5-7-9(3,14-8)10(11,12)13/h4H,1,5-7H2,2-3H3 |
| InChIKey | KHPVPTXPFLSXLI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane?
The IUPAC name of 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane (CID 23405418) is 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane.
What is the SMILES notation for 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane?
The canonical SMILES for 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane is C=CC1(C)CCCC(C)(C(F)(F)F)O1.
What is the InChIKey of 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane?
The InChIKey is KHPVPTXPFLSXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O/c1-4-8(2)6-5-7-9(3,14-8)10(11,12)13/h4H,1,5-7H2,2-3H3.
What are the key properties of 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane?
2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane has a molecular weight of 208.22 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2,6-dimethyl-6-(trifluoromethyl)oxane is sourced from PubChem (CID 23405418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).