C17H24F6O3 — CID 23405527
3a-ethenyl-7a-(2-methoxyethoxymethoxy)-7,7-bis(trifluoromethyl)-1,2,3,4,5,6-hexahydroindene (PubChem CID 23405527) has the molecular formula C17H24F6O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 3a-ethenyl-7a-(2-methoxyethoxymethoxy)-7,7-bis(trifluoromethyl)-1,2,3,4,5,6-hexahydroindene.
| Compound Name | 3a-ethenyl-7a-(2-methoxyethoxymethoxy)-7,7-bis(trifluoromethyl)-1,2,3,4,5,6-hexahydroindene |
|---|---|
| PubChem CID | 23405527 |
| Molecular Formula | C17H24F6O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3a-ethenyl-7a-(2-methoxyethoxymethoxy)-7,7-bis(trifluoromethyl)-1,2,3,4,5,6-hexahydroindene |
| SMILES | C=CC12CCCC1(OCOCCOC)C(C(F)(F)F)(C(F)(F)F)CCC2 |
| InChI | InChI=1S/C17H24F6O3/c1-3-13-6-4-8-14(16(18,19)20,17(21,22)23)15(13,9-5-7-13)26-12-25-11-10-24-2/h3H,1,4-12H2,2H3 |
| InChIKey | IWBZQKWKDIEXIV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|