C36H49Cl3F6O7 — CID 23405542
3-[3-[6-(2-methoxyethoxymethoxy)-5,5-bis(trifluoromethyl)-2-tricyclo[5.2.1.02,6]decanyl]butyl]-4-[2,2,4,7-tetramethyl-4-(trichloromethyl)-3-oxabicyclo[3.2.1]octan-6-yl]oxolane-2,5-dione (PubChem CID 23405542) has the molecular formula C36H49Cl3F6O7 and a molecular weight of 814.13 g/mol. Its IUPAC name is 3-[3-[6-(2-methoxyethoxymethoxy)-5,5-bis(trifluoromethyl)-2-tricyclo[5.2.1.02,6]decanyl]butyl]-4-[2,2,4,7-tetramethyl-4-(trichloromethyl)-3-oxabicyclo[3.2.1]octan-6-yl]oxolane-2,5-dione.
| Compound Name | 3-[3-[6-(2-methoxyethoxymethoxy)-5,5-bis(trifluoromethyl)-2-tricyclo[5.2.1.02,6]decanyl]butyl]-4-[2,2,4,7-tetramethyl-4-(trichloromethyl)-3-oxabicyclo[3.2.1]octan-6-yl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 23405542 |
| Molecular Formula | C36H49Cl3F6O7 |
| Molecular Weight | 814.13 g/mol |
| Exact Mass | 812.24 |
| IUPAC Name | 3-[3-[6-(2-methoxyethoxymethoxy)-5,5-bis(trifluoromethyl)-2-tricyclo[5.2.1.02,6]decanyl]butyl]-4-[2,2,4,7-tetramethyl-4-(trichloromethyl)-3-oxabicyclo[3.2.1]octan-6-yl]oxolane-2,5-dione |
| SMILES | COCCOCOC12C3CCC(C3)C1(C(C)CCC1C(=O)OC(=O)C1C1C(C)C3CC1C(C)(C(Cl)(Cl)Cl)OC3(C)C)CCC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C36H49Cl3F6O7/c1-18(7-10-22-26(28(47)51-27(22)46)25-19(2)23-16-24(25)30(5,34(37,38)39)52-29(23,3)4)31-11-12-32(35(40,41)42,36(43,44)45)33(31,21-9-8-20(31)15-21)50-17-49-14-13-48-6/h18-26H,7-17H2,1-6H3 |
| InChIKey | OGCVZZDMWBIXEU-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.13 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|