C21H38N2O3 — CID 23405567
N-[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]-4-ethoxybutanamide (PubChem CID 23405567) has the molecular formula C21H38N2O3 and a molecular weight of 366.55 g/mol. Its IUPAC name is N-[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]-4-ethoxybutanamide.
| Compound Name | N-[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]-4-ethoxybutanamide |
|---|---|
| PubChem CID | 23405567 |
| Molecular Formula | C21H38N2O3 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | N-[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)NC1CCC(CC2CCC(NC(C)=O)CC2)CC1 |
| InChI | InChI=1S/C21H38N2O3/c1-3-26-14-4-5-21(25)23-20-12-8-18(9-13-20)15-17-6-10-19(11-7-17)22-16(2)24/h17-20H,3-15H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | QOAAQSWJJVULPV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|