C48H38N2O6 — CID 23405966
1-[3-[4-[4-[3,5-bis(prop-2-enoxy)benzoyl]phenoxy]phenyl]-2-[4-(4-methylphenoxy)phenyl]quinoxalin-6-yl]ethanone (PubChem CID 23405966) has the molecular formula C48H38N2O6 and a molecular weight of 738.84 g/mol. Its IUPAC name is 1-[3-[4-[4-[3,5-bis(prop-2-enoxy)benzoyl]phenoxy]phenyl]-2-[4-(4-methylphenoxy)phenyl]quinoxalin-6-yl]ethanone.
| Compound Name | 1-[3-[4-[4-[3,5-bis(prop-2-enoxy)benzoyl]phenoxy]phenyl]-2-[4-(4-methylphenoxy)phenyl]quinoxalin-6-yl]ethanone |
|---|---|
| PubChem CID | 23405966 |
| Molecular Formula | C48H38N2O6 |
| Molecular Weight | 738.84 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | 1-[3-[4-[4-[3,5-bis(prop-2-enoxy)benzoyl]phenoxy]phenyl]-2-[4-(4-methylphenoxy)phenyl]quinoxalin-6-yl]ethanone |
| SMILES | C=CCOc1cc(OCC=C)cc(C(=O)c2ccc(Oc3ccc(-c4nc5cc(C(C)=O)ccc5nc4-c4ccc(Oc5ccc(C)cc5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C48H38N2O6/c1-5-25-53-42-27-37(28-43(30-42)54-26-6-2)48(52)35-13-22-41(23-14-35)56-40-20-11-34(12-21-40)47-46(49-44-24-15-36(32(4)51)29-45(44)50-47)33-9-18-39(19-10-33)55-38-16-7-31(3)8-17-38/h5-24,27-30H,1-2,25-26H2,3-4H3 |
| InChIKey | SXMFXPKDYYXCHB-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.84 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|