C20H19N2O3S- — CID 2340719
2-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylpyridine-3-carboxylate (PubChem CID 2340719) has the molecular formula C20H19N2O3S- and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2340719 |
| Molecular Formula | C20H19N2O3S- |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylpyridine-3-carboxylate |
| SMILES | CN1/C(=C\C(=O)CSc2ncccc2C(=O)[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O3S/c1-20(2)15-8-4-5-9-16(15)22(3)17(20)11-13(23)12-26-18-14(19(24)25)7-6-10-21-18/h4-11H,12H2,1-3H3,(H,24,25)/p-1/b17-11- |
| InChIKey | UEQBXLGGWPHKRW-BOPFTXTBSA-M |
| XLogP | 2.42 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|