C17H24N4O4S2 — CID 23407480
2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 23407480) has the molecular formula C17H24N4O4S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 23407480 |
| Molecular Formula | C17H24N4O4S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SCC(=O)NCCOC |
| InChI | InChI=1S/C17H24N4O4S2/c1-4-21-15(12-27(23,24)14-7-5-13(2)6-8-14)19-20-17(21)26-11-16(22)18-9-10-25-3/h5-8H,4,9-12H2,1-3H3,(H,18,22) |
| InChIKey | UTIMWRHOBWPIQE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|