C18H22ClN3O4 — CID 2340853
N-(3-chloro-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide (PubChem CID 2340853) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
|---|---|
| PubChem CID | 2340853 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)NC3(CCCCCC3)C2=O)cc1Cl |
| InChI | InChI=1S/C18H22ClN3O4/c1-26-14-7-6-12(10-13(14)19)20-15(23)11-22-16(24)18(21-17(22)25)8-4-2-3-5-9-18/h6-7,10H,2-5,8-9,11H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | WOGBFTSSFMBSTP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|