C21H16N4O5S2 — CID 23409383
N-(4-methoxy-2-nitrophenyl)-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 23409383) has the molecular formula C21H16N4O5S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 23409383 |
| Molecular Formula | C21H16N4O5S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16N4O5S2/c1-30-13-7-8-15(16(9-13)25(28)29)22-17(26)11-32-21-23-19(27)18-14(10-31-20(18)24-21)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,22,26)(H,23,24,27) |
| InChIKey | YKXMVVUBMQSZLX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|