About [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate (PubChem CID 2341009) has the molecular formula C18H12ClFN2O3S
and a molecular weight of 390.82 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate |
| PubChem CID | 2341009 |
| Molecular Formula | C18H12ClFN2O3S |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1Cl)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H12ClFN2O3S/c19-14-8-12(20)6-7-13(14)17(24)25-9-16(23)22-18-21-15(10-26-18)11-4-2-1-3-5-11/h1-8,10H,9H2,(H,21,22,23) |
| InChIKey | PLUXZFAPFUTKLX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate?
The IUPAC name of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate (CID 2341009) is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate.
What is the SMILES notation for [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate?
The canonical SMILES for [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate is O=C(COC(=O)c1ccc(F)cc1Cl)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate?
The InChIKey is PLUXZFAPFUTKLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN2O3S/c19-14-8-12(20)6-7-13(14)17(24)25-9-16(23)22-18-21-15(10-26-18)11-4-2-1-3-5-11/h1-8,10H,9H2,(H,21,22,23).
What are the key properties of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate?
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate has a molecular weight of 390.82 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-chloro-4-fluorobenzoate is sourced from PubChem (CID 2341009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).