C17H16N4O3S2 — CID 23410257
N'-acetyl-2-[(6-methyl-4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetohydrazide (PubChem CID 23410257) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N'-acetyl-2-[(6-methyl-4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[(6-methyl-4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 23410257 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N'-acetyl-2-[(6-methyl-4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nc2sc(C)c(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-9-13(11-6-4-3-5-7-11)14-15(24)18-17(19-16(14)26-9)25-8-12(23)21-20-10(2)22/h3-7H,8H2,1-2H3,(H,20,22)(H,21,23)(H,18,19,24) |
| InChIKey | CHEOZKIPPIHULP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|