C18H17BrN2OS — CID 23411731
5-(4-bromophenyl)-6-ethyl-3-(2-methylprop-2-enyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 23411731) has the molecular formula C18H17BrN2OS and a molecular weight of 389.32 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-ethyl-3-(2-methylprop-2-enyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-bromophenyl)-6-ethyl-3-(2-methylprop-2-enyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23411731 |
| Molecular Formula | C18H17BrN2OS |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 5-(4-bromophenyl)-6-ethyl-3-(2-methylprop-2-enyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=C(C)Cn1cnc2sc(CC)c(-c3ccc(Br)cc3)c2c1=O |
| InChI | InChI=1S/C18H17BrN2OS/c1-4-14-15(12-5-7-13(19)8-6-12)16-17(23-14)20-10-21(18(16)22)9-11(2)3/h5-8,10H,2,4,9H2,1,3H3 |
| InChIKey | JJNRMLRNHBJYAI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|