C9H6Cl2N4S — CID 23412130
5-(3,5-dichloroanilino)-2H-1,2,4-triazine-3-thione (PubChem CID 23412130) has the molecular formula C9H6Cl2N4S and a molecular weight of 273.15 g/mol. Its IUPAC name is 5-(3,5-dichloroanilino)-2H-1,2,4-triazine-3-thione.
| Compound Name | 5-(3,5-dichloroanilino)-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 23412130 |
| Molecular Formula | C9H6Cl2N4S |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 5-(3,5-dichloroanilino)-2H-1,2,4-triazine-3-thione |
| SMILES | S=c1nc(Nc2cc(Cl)cc(Cl)c2)cn[nH]1 |
| InChI | InChI=1S/C9H6Cl2N4S/c10-5-1-6(11)3-7(2-5)13-8-4-12-15-9(16)14-8/h1-4H,(H2,13,14,15,16) |
| InChIKey | JASMNEXOWHNXNA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|