About 5-(decylamino)-2H-1,2,4-triazine-3-thione
5-(decylamino)-2H-1,2,4-triazine-3-thione (PubChem CID 23412228) has the molecular formula C13H24N4S
and a molecular weight of 268.43 g/mol. Its IUPAC name is 5-(decylamino)-2H-1,2,4-triazine-3-thione.
Molecular Properties
| Compound Name | 5-(decylamino)-2H-1,2,4-triazine-3-thione |
| PubChem CID | 23412228 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-(decylamino)-2H-1,2,4-triazine-3-thione |
| SMILES | CCCCCCCCCCNc1cn[nH]c(=S)n1 |
| InChI | InChI=1S/C13H24N4S/c1-2-3-4-5-6-7-8-9-10-14-12-11-15-17-13(18)16-12/h11H,2-10H2,1H3,(H2,14,16,17,18) |
| InChIKey | HXQNOICWQPAARH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(decylamino)-2H-1,2,4-triazine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(decylamino)-2H-1,2,4-triazine-3-thione?
The IUPAC name of 5-(decylamino)-2H-1,2,4-triazine-3-thione (CID 23412228) is 5-(decylamino)-2H-1,2,4-triazine-3-thione.
What is the SMILES notation for 5-(decylamino)-2H-1,2,4-triazine-3-thione?
The canonical SMILES for 5-(decylamino)-2H-1,2,4-triazine-3-thione is CCCCCCCCCCNc1cn[nH]c(=S)n1.
What is the InChIKey of 5-(decylamino)-2H-1,2,4-triazine-3-thione?
The InChIKey is HXQNOICWQPAARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4S/c1-2-3-4-5-6-7-8-9-10-14-12-11-15-17-13(18)16-12/h11H,2-10H2,1H3,(H2,14,16,17,18).
What are the key properties of 5-(decylamino)-2H-1,2,4-triazine-3-thione?
5-(decylamino)-2H-1,2,4-triazine-3-thione has a molecular weight of 268.43 g/mol, XLogP of 4.09, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(decylamino)-2H-1,2,4-triazine-3-thione is sourced from PubChem (CID 23412228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).