C16H17N5S — CID 23412328
6-methyl-5-[2-(naphthalen-1-ylamino)ethylamino]-2H-1,2,4-triazine-3-thione (PubChem CID 23412328) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is 6-methyl-5-[2-(naphthalen-1-ylamino)ethylamino]-2H-1,2,4-triazine-3-thione.
| Compound Name | 6-methyl-5-[2-(naphthalen-1-ylamino)ethylamino]-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 23412328 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 6-methyl-5-[2-(naphthalen-1-ylamino)ethylamino]-2H-1,2,4-triazine-3-thione |
| SMILES | Cc1n[nH]c(=S)nc1NCCNc1cccc2ccccc12 |
| InChI | InChI=1S/C16H17N5S/c1-11-15(19-16(22)21-20-11)18-10-9-17-14-8-4-6-12-5-2-3-7-13(12)14/h2-8,17H,9-10H2,1H3,(H2,18,19,21,22) |
| InChIKey | OZZKADMOAIENIJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|