About (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate
(4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate (PubChem CID 23412655) has the molecular formula C14H20ClO3PS2
and a molecular weight of 366.87 g/mol. Its IUPAC name is (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate |
| PubChem CID | 23412655 |
| Molecular Formula | C14H20ClO3PS2 |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate |
| SMILES | CC(C)OP(=O)(OC(C)C)C(=S)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClO3PS2/c1-10(2)17-19(16,18-11(3)4)14(20)21-9-12-5-7-13(15)8-6-12/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | TZKBJHJPKILBQI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate?
The IUPAC name of (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate (CID 23412655) is (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate.
What is the SMILES notation for (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate?
The canonical SMILES for (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate is CC(C)OP(=O)(OC(C)C)C(=S)SCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate?
The InChIKey is TZKBJHJPKILBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClO3PS2/c1-10(2)17-19(16,18-11(3)4)14(20)21-9-12-5-7-13(15)8-6-12/h5-8,10-11H,9H2,1-4H3.
What are the key properties of (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate?
(4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate has a molecular weight of 366.87 g/mol, XLogP of 5.90, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl di(propan-2-yloxy)phosphorylmethanedithioate is sourced from PubChem (CID 23412655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).