C19H21N2O3P — CID 23413132
2-methoxy-1,3-dimethylspiro[1,3-diaza-2λ5-phosphacyclopentane-2,4'-3,5-dioxa-4λ5-phosphatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7,9,11,13,15-heptaene] (PubChem CID 23413132) has the molecular formula C19H21N2O3P and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-methoxy-1,3-dimethylspiro[1,3-diaza-2λ5-phosphacyclopentane-2,4'-3,5-dioxa-4λ5-phosphatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7,9,11,13,15-heptaene].
| Compound Name | 2-methoxy-1,3-dimethylspiro[1,3-diaza-2λ5-phosphacyclopentane-2,4'-3,5-dioxa-4λ5-phosphatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7,9,11,13,15-heptaene] |
|---|---|
| PubChem CID | 23413132 |
| Molecular Formula | C19H21N2O3P |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-methoxy-1,3-dimethylspiro[1,3-diaza-2λ5-phosphacyclopentane-2,4'-3,5-dioxa-4λ5-phosphatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7,9,11,13,15-heptaene] |
| SMILES | COP12(Oc3c(c4ccccc4c4ccccc34)O1)N(C)CCN2C |
| InChI | InChI=1S/C19H21N2O3P/c1-20-12-13-21(2)25(20,22-3)23-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)19(18)24-25/h4-11H,12-13H2,1-3H3 |
| InChIKey | JRSRKTFQEWYOHV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|