C11H25O5P — CID 23413172
2,2,2-triethoxy-5,5-dimethyl-1,3,2λ5-dioxaphosphinane (PubChem CID 23413172) has the molecular formula C11H25O5P and a molecular weight of 268.29 g/mol. Its IUPAC name is 2,2,2-triethoxy-5,5-dimethyl-1,3,2λ5-dioxaphosphinane.
| Compound Name | 2,2,2-triethoxy-5,5-dimethyl-1,3,2λ5-dioxaphosphinane |
|---|---|
| PubChem CID | 23413172 |
| Molecular Formula | C11H25O5P |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2,2,2-triethoxy-5,5-dimethyl-1,3,2λ5-dioxaphosphinane |
| SMILES | CCOP1(OCC)(OCC)OCC(C)(C)CO1 |
| InChI | InChI=1S/C11H25O5P/c1-6-12-17(13-7-2,14-8-3)15-9-11(4,5)10-16-17/h6-10H2,1-5H3 |
| InChIKey | ZXGJVKUSCZBTBF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|