C17H17O5P — CID 23413181
5-methoxy-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene (PubChem CID 23413181) has the molecular formula C17H17O5P and a molecular weight of 332.29 g/mol. Its IUPAC name is 5-methoxy-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene.
| Compound Name | 5-methoxy-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene |
|---|---|
| PubChem CID | 23413181 |
| Molecular Formula | C17H17O5P |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 5-methoxy-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene |
| SMILES | COP12(OCCO1)OC(c1ccccc1)=C(c1ccccc1)O2 |
| InChI | InChI=1S/C17H17O5P/c1-18-23(19-12-13-20-23)21-16(14-8-4-2-5-9-14)17(22-23)15-10-6-3-7-11-15/h2-11H,12-13H2,1H3 |
| InChIKey | YTZNQJADHOSZGS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|