C10H9Cl2N2O2PS — CID 23413352
methyl 2-(2-dichlorophosphanylimino-1,3-benzothiazol-3-yl)acetate (PubChem CID 23413352) has the molecular formula C10H9Cl2N2O2PS and a molecular weight of 323.14 g/mol. Its IUPAC name is methyl 2-(2-dichlorophosphanylimino-1,3-benzothiazol-3-yl)acetate.
| Compound Name | methyl 2-(2-dichlorophosphanylimino-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 23413352 |
| Molecular Formula | C10H9Cl2N2O2PS |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | methyl 2-(2-dichlorophosphanylimino-1,3-benzothiazol-3-yl)acetate |
| SMILES | COC(=O)Cn1c(=NP(Cl)Cl)sc2ccccc21 |
| InChI | InChI=1S/C10H9Cl2N2O2PS/c1-16-9(15)6-14-7-4-2-3-5-8(7)18-10(14)13-17(11)12/h2-5H,6H2,1H3 |
| InChIKey | CRSAGBRQCMSOSU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|