About 3-phenyl-4H-1,2,4-diazaphosphole
3-phenyl-4H-1,2,4-diazaphosphole (PubChem CID 23413742) has the molecular formula C8H7N2P
and a molecular weight of 162.13 g/mol. Its IUPAC name is 3-phenyl-4H-1,2,4-diazaphosphole.
Molecular Properties
| Compound Name | 3-phenyl-4H-1,2,4-diazaphosphole |
| PubChem CID | 23413742 |
| Molecular Formula | C8H7N2P |
| Molecular Weight | 162.13 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 3-phenyl-4H-1,2,4-diazaphosphole |
| SMILES | c1ccc(-c2nnc[pH]2)cc1 |
| InChI | InChI=1S/C8H7N2P/c1-2-4-7(5-3-1)8-10-9-6-11-8/h1-6,11H |
| InChIKey | BJCCRVYUUGDLGP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-4H-1,2,4-diazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-4H-1,2,4-diazaphosphole?
The IUPAC name of 3-phenyl-4H-1,2,4-diazaphosphole (CID 23413742) is 3-phenyl-4H-1,2,4-diazaphosphole.
What is the SMILES notation for 3-phenyl-4H-1,2,4-diazaphosphole?
The canonical SMILES for 3-phenyl-4H-1,2,4-diazaphosphole is c1ccc(-c2nnc[pH]2)cc1.
What is the InChIKey of 3-phenyl-4H-1,2,4-diazaphosphole?
The InChIKey is BJCCRVYUUGDLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2P/c1-2-4-7(5-3-1)8-10-9-6-11-8/h1-6,11H.
What are the key properties of 3-phenyl-4H-1,2,4-diazaphosphole?
3-phenyl-4H-1,2,4-diazaphosphole has a molecular weight of 162.13 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-4H-1,2,4-diazaphosphole is sourced from PubChem (CID 23413742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).