C18H22P2 — CID 23413764
(2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)phosphanylidenephosphane (PubChem CID 23413764) has the molecular formula C18H22P2 and a molecular weight of 300.32 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)phosphanylidenephosphane.
| Compound Name | (2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)phosphanylidenephosphane |
|---|---|
| PubChem CID | 23413764 |
| Molecular Formula | C18H22P2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (2,4,6-trimethylphenyl)-(2,4,6-trimethylphenyl)phosphanylidenephosphane |
| SMILES | Cc1cc(C)c(/P=P/c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22P2/c1-11-7-13(3)17(14(4)8-11)19-20-18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | BFPVTNQLXAWTTC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|