About CID 23413867
CID 23413867 (PubChem CID 23413867) has the molecular formula F6N3P
and a molecular weight of 186.98 g/mol.
Molecular Properties
| Compound Name | CID 23413867 |
| PubChem CID | 23413867 |
| Molecular Formula | F6N3P |
| Molecular Weight | 186.98 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | — |
| SMILES | FN(F)P(N(F)F)N(F)F |
| InChI | InChI=1S/F6N3P/c1-7(2)10(8(3)4)9(5)6 |
| InChIKey | MUHBBHOAJRTHLJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.98 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 23413867 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23413867?
The IUPAC name of CID 23413867 (CID 23413867) is not available.
What is the SMILES notation for CID 23413867?
The canonical SMILES for CID 23413867 is FN(F)P(N(F)F)N(F)F.
What is the InChIKey of CID 23413867?
The InChIKey is MUHBBHOAJRTHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/F6N3P/c1-7(2)10(8(3)4)9(5)6.
What are the key properties of CID 23413867?
CID 23413867 has a molecular weight of 186.98 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23413867 is sourced from PubChem (CID 23413867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).